C29H36O6 — CID 70391331
methyl (E)-7-[2-[2,2-dimethylbutanoyloxy(phenyl)methyl]-4,6-dimethylphenyl]-5-hydroxy-2-oxohept-6-enoate (PubChem CID 70391331) has the molecular formula C29H36O6 and a molecular weight of 480.60 g/mol. Its IUPAC name is methyl (E)-7-[2-[2,2-dimethylbutanoyloxy(phenyl)methyl]-4,6-dimethylphenyl]-5-hydroxy-2-oxohept-6-enoate.
| Compound Name | methyl (E)-7-[2-[2,2-dimethylbutanoyloxy(phenyl)methyl]-4,6-dimethylphenyl]-5-hydroxy-2-oxohept-6-enoate |
|---|---|
| PubChem CID | 70391331 |
| Molecular Formula | C29H36O6 |
| Molecular Weight | 480.60 g/mol |
| Exact Mass | 480.25 |
| IUPAC Name | methyl (E)-7-[2-[2,2-dimethylbutanoyloxy(phenyl)methyl]-4,6-dimethylphenyl]-5-hydroxy-2-oxohept-6-enoate |
| SMILES | CCC(C)(C)C(=O)OC(c1ccccc1)c1cc(C)cc(C)c1/C=C/C(O)CCC(=O)C(=O)OC |
| InChI | InChI=1S/C29H36O6/c1-7-29(4,5)28(33)35-26(21-11-9-8-10-12-21)24-18-19(2)17-20(3)23(24)15-13-22(30)14-16-25(31)27(32)34-6/h8-13,15,17-18,22,26,30H,7,14,16H2,1-6H3/b15-13+ |
| InChIKey | XCFIWCHUEJFLPJ-FYWRMAATSA-N |
| XLogP | 5.27 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.60 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|