C22H27N3O5S — CID 154504774
tert-butyl 3-tert-butylsulfinylimino-5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxoindole-1-carboxylate (PubChem CID 154504774) has the molecular formula C22H27N3O5S and a molecular weight of 445.54 g/mol. Its IUPAC name is tert-butyl 3-tert-butylsulfinylimino-5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxoindole-1-carboxylate.
| Compound Name | tert-butyl 3-tert-butylsulfinylimino-5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxoindole-1-carboxylate |
|---|---|
| PubChem CID | 154504774 |
| Molecular Formula | C22H27N3O5S |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | tert-butyl 3-tert-butylsulfinylimino-5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxoindole-1-carboxylate |
| SMILES | Cc1noc(C)c1-c1ccc2c(c1)C(=NS(=O)C(C)(C)C)C(=O)N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H27N3O5S/c1-12-17(13(2)30-23-12)14-9-10-16-15(11-14)18(24-31(28)22(6,7)8)19(26)25(16)20(27)29-21(3,4)5/h9-11H,1-8H3 |
| InChIKey | JPEDMQDHIPYCMS-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 102.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|