C6H8F2N2 — CID 154521242
(4,4-difluorocyclohexa-1,5-dien-1-yl)hydrazine (PubChem CID 154521242) has the molecular formula C6H8F2N2 and a molecular weight of 146.14 g/mol. Its IUPAC name is (4,4-difluorocyclohexa-1,5-dien-1-yl)hydrazine.
| Compound Name | (4,4-difluorocyclohexa-1,5-dien-1-yl)hydrazine |
|---|---|
| PubChem CID | 154521242 |
| Molecular Formula | C6H8F2N2 |
| Molecular Weight | 146.14 g/mol |
| Exact Mass | 146.07 |
| IUPAC Name | (4,4-difluorocyclohexa-1,5-dien-1-yl)hydrazine |
| SMILES | NNC1=CCC(F)(F)C=C1 |
| InChI | InChI=1S/C6H8F2N2/c7-6(8)3-1-5(10-9)2-4-6/h1-3,10H,4,9H2 |
| InChIKey | FHKYDSWYRPOORK-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.14 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|