C7H5F3N2Np2-2 — CID 163600058
neptunium;[4-(trifluoromethyl)benzene-3,5-diid-1-yl]hydrazine (PubChem CID 163600058) has the molecular formula C7H5F3N2Np2-2 and a molecular weight of 648.12 g/mol. Its IUPAC name is neptunium;[4-(trifluoromethyl)benzene-3,5-diid-1-yl]hydrazine.
| Compound Name | neptunium;[4-(trifluoromethyl)benzene-3,5-diid-1-yl]hydrazine |
|---|---|
| PubChem CID | 163600058 |
| Molecular Formula | C7H5F3N2Np2-2 |
| Molecular Weight | 648.12 g/mol |
| Exact Mass | 646.13 |
| IUPAC Name | neptunium;[4-(trifluoromethyl)benzene-3,5-diid-1-yl]hydrazine |
| SMILES | NNc1c[c-]c(C(F)(F)F)[c-]c1.[Np].[Np] |
| InChI | InChI=1S/C7H5F3N2.2Np/c8-7(9,10)5-1-3-6(12-11)4-2-5;;/h3-4,12H,11H2;;/q-2;; |
| InChIKey | CRYAHLOAABLMLS-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.12 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|