C23H21NO2S2 — CID 154521267
2-(benzenesulfinyl)-1-[4-(5-thiophen-2-ylpent-3-ynylamino)phenyl]ethanone (PubChem CID 154521267) has the molecular formula C23H21NO2S2 and a molecular weight of 407.56 g/mol. Its IUPAC name is 2-(benzenesulfinyl)-1-[4-(5-thiophen-2-ylpent-3-ynylamino)phenyl]ethanone.
| Compound Name | 2-(benzenesulfinyl)-1-[4-(5-thiophen-2-ylpent-3-ynylamino)phenyl]ethanone |
|---|---|
| PubChem CID | 154521267 |
| Molecular Formula | C23H21NO2S2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | 2-(benzenesulfinyl)-1-[4-(5-thiophen-2-ylpent-3-ynylamino)phenyl]ethanone |
| SMILES | O=C(CS(=O)c1ccccc1)c1ccc(NCCC#CCc2cccs2)cc1 |
| InChI | InChI=1S/C23H21NO2S2/c25-23(18-28(26)22-10-4-1-5-11-22)19-12-14-20(15-13-19)24-16-6-2-3-8-21-9-7-17-27-21/h1,4-5,7,9-15,17,24H,6,8,16,18H2 |
| InChIKey | ADJWASZBKCOMKN-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|