C27H31FN4O4 — CID 154529698
2-[N-[3-amino-2-[(4-fluorophenyl)iminomethyl]but-2-enoyl]-3-cyano-4-(2,2-dimethylpropoxy)anilino]ethyl acetate (PubChem CID 154529698) has the molecular formula C27H31FN4O4 and a molecular weight of 494.57 g/mol. Its IUPAC name is 2-[N-[3-amino-2-[(4-fluorophenyl)iminomethyl]but-2-enoyl]-3-cyano-4-(2,2-dimethylpropoxy)anilino]ethyl acetate.
| Compound Name | 2-[N-[3-amino-2-[(4-fluorophenyl)iminomethyl]but-2-enoyl]-3-cyano-4-(2,2-dimethylpropoxy)anilino]ethyl acetate |
|---|---|
| PubChem CID | 154529698 |
| Molecular Formula | C27H31FN4O4 |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | 2-[N-[3-amino-2-[(4-fluorophenyl)iminomethyl]but-2-enoyl]-3-cyano-4-(2,2-dimethylpropoxy)anilino]ethyl acetate |
| SMILES | CC(=O)OCCN(C(=O)C(/C=N/c1ccc(F)cc1)=C(C)N)c1ccc(OCC(C)(C)C)c(C#N)c1 |
| InChI | InChI=1S/C27H31FN4O4/c1-18(30)24(16-31-22-8-6-21(28)7-9-22)26(34)32(12-13-35-19(2)33)23-10-11-25(20(14-23)15-29)36-17-27(3,4)5/h6-11,14,16H,12-13,17,30H2,1-5H3/b24-18?,31-16+ |
| InChIKey | DKYWVFLDVNMGDO-CVEAJQSGSA-N |
| XLogP | 4.65 |
| TPSA | 118.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|