C15H19F3N4 — CID 154536401
[4-[1-methyl-6-(trifluoromethyl)indazol-3-yl]piperidin-1-yl]methanamine (PubChem CID 154536401) has the molecular formula C15H19F3N4 and a molecular weight of 312.34 g/mol. Its IUPAC name is [4-[1-methyl-6-(trifluoromethyl)indazol-3-yl]piperidin-1-yl]methanamine.
| Compound Name | [4-[1-methyl-6-(trifluoromethyl)indazol-3-yl]piperidin-1-yl]methanamine |
|---|---|
| PubChem CID | 154536401 |
| Molecular Formula | C15H19F3N4 |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | [4-[1-methyl-6-(trifluoromethyl)indazol-3-yl]piperidin-1-yl]methanamine |
| SMILES | Cn1nc(C2CCN(CN)CC2)c2ccc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C15H19F3N4/c1-21-13-8-11(15(16,17)18)2-3-12(13)14(20-21)10-4-6-22(9-19)7-5-10/h2-3,8,10H,4-7,9,19H2,1H3 |
| InChIKey | LALYPBRBVLZVGR-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |