C7H12N2 — CID 154539742
1-cyclopentylethane-1,2-diimine (PubChem CID 154539742) has the molecular formula C7H12N2 and a molecular weight of 124.19 g/mol. Its IUPAC name is 1-cyclopentylethane-1,2-diimine.
| Compound Name | 1-cyclopentylethane-1,2-diimine |
|---|---|
| PubChem CID | 154539742 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | 1-cyclopentylethane-1,2-diimine |
| SMILES | [H]/N=C(\C=N\[H])C1CCCC1 |
| InChI | InChI=1S/C7H12N2/c8-5-7(9)6-3-1-2-4-6/h5-6,8-9H,1-4H2/b8-5+,9-7+ |
| InChIKey | QUFZJQLWBYEOTP-OCIXRKKMSA-N |
| XLogP | 1.85 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|