C21H27N3O4 — CID 154565405
(6S,7S,8aS)-6-ethyl-N-(2-hydroxyethyl)-4-oxo-2-[(E)-3-phenylprop-2-enoyl]-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxamide (PubChem CID 154565405) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is (6S,7S,8aS)-6-ethyl-N-(2-hydroxyethyl)-4-oxo-2-[(E)-3-phenylprop-2-enoyl]-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxamide.
| Compound Name | (6S,7S,8aS)-6-ethyl-N-(2-hydroxyethyl)-4-oxo-2-[(E)-3-phenylprop-2-enoyl]-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 154565405 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | (6S,7S,8aS)-6-ethyl-N-(2-hydroxyethyl)-4-oxo-2-[(E)-3-phenylprop-2-enoyl]-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxamide |
| SMILES | CC[C@H]1[C@@H](C(=O)NCCO)C[C@H]2CN(C(=O)/C=C/c3ccccc3)CC(=O)N21 |
| InChI | InChI=1S/C21H27N3O4/c1-2-18-17(21(28)22-10-11-25)12-16-13-23(14-20(27)24(16)18)19(26)9-8-15-6-4-3-5-7-15/h3-9,16-18,25H,2,10-14H2,1H3,(H,22,28)/b9-8+/t16-,17-,18-/m0/s1 |
| InChIKey | WVRCFBPZETTWAL-XOQOMHCNSA-N |
| XLogP | 0.65 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|