C35H43N5O7 — CID 154567341
(18S,21S)-4,26-dimethoxy-21-methyl-18-(2-phenylethyl)-2-oxa-9,14,17,20,23-pentazatricyclo[23.2.2.13,7]triaconta-1(27),3,5,7(30),25,28-hexaene-8,16,19,22-tetrone (PubChem CID 154567341) has the molecular formula C35H43N5O7 and a molecular weight of 645.76 g/mol. Its IUPAC name is (18S,21S)-4,26-dimethoxy-21-methyl-18-(2-phenylethyl)-2-oxa-9,14,17,20,23-pentazatricyclo[23.2.2.13,7]triaconta-1(27),3,5,7(30),25,28-hexaene-8,16,19,22-tetrone.
| Compound Name | (18S,21S)-4,26-dimethoxy-21-methyl-18-(2-phenylethyl)-2-oxa-9,14,17,20,23-pentazatricyclo[23.2.2.13,7]triaconta-1(27),3,5,7(30),25,28-hexaene-8,16,19,22-tetrone |
|---|---|
| PubChem CID | 154567341 |
| Molecular Formula | C35H43N5O7 |
| Molecular Weight | 645.76 g/mol |
| Exact Mass | 645.32 |
| IUPAC Name | (18S,21S)-4,26-dimethoxy-21-methyl-18-(2-phenylethyl)-2-oxa-9,14,17,20,23-pentazatricyclo[23.2.2.13,7]triaconta-1(27),3,5,7(30),25,28-hexaene-8,16,19,22-tetrone |
| SMILES | COc1cc2ccc1CNC(=O)[C@H](C)NC(=O)[C@H](CCc1ccccc1)NC(=O)CNCCCCNC(=O)c1ccc(OC)c(c1)O2 |
| InChI | InChI=1S/C35H43N5O7/c1-23-33(42)38-21-26-12-14-27(20-30(26)46-3)47-31-19-25(13-16-29(31)45-2)34(43)37-18-8-7-17-36-22-32(41)40-28(35(44)39-23)15-11-24-9-5-4-6-10-24/h4-6,9-10,12-14,16,19-20,23,28,36H,7-8,11,15,17-18,21-22H2,1-3H3,(H,37,43)(H,38,42)(H,39,44)(H,40,41)/t23-,28-/m0/s1 |
| InChIKey | QGBHXSWLJYZFCU-FIPFOOKPSA-N |
| XLogP | 2.85 |
| TPSA | 156.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.76 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|