About methyl 5-bromo-2-ethyl-1,2,4-triazole-3-carboxylate
methyl 5-bromo-2-ethyl-1,2,4-triazole-3-carboxylate (PubChem CID 154577097) has the molecular formula C6H8BrN3O2
and a molecular weight of 234.05 g/mol. Its IUPAC name is methyl 5-bromo-2-ethyl-1,2,4-triazole-3-carboxylate.
Molecular Properties
| Compound Name | methyl 5-bromo-2-ethyl-1,2,4-triazole-3-carboxylate |
| PubChem CID | 154577097 |
| Molecular Formula | C6H8BrN3O2 |
| Molecular Weight | 234.05 g/mol |
| Exact Mass | 232.98 |
| IUPAC Name | methyl 5-bromo-2-ethyl-1,2,4-triazole-3-carboxylate |
| SMILES | CCn1nc(Br)nc1C(=O)OC |
| InChI | InChI=1S/C6H8BrN3O2/c1-3-10-4(5(11)12-2)8-6(7)9-10/h3H2,1-2H3 |
| InChIKey | RZQROLDLPQVCSF-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.05 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 5-bromo-2-ethyl-1,2,4-triazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-bromo-2-ethyl-1,2,4-triazole-3-carboxylate?
The IUPAC name of methyl 5-bromo-2-ethyl-1,2,4-triazole-3-carboxylate (CID 154577097) is methyl 5-bromo-2-ethyl-1,2,4-triazole-3-carboxylate.
What is the SMILES notation for methyl 5-bromo-2-ethyl-1,2,4-triazole-3-carboxylate?
The canonical SMILES for methyl 5-bromo-2-ethyl-1,2,4-triazole-3-carboxylate is CCn1nc(Br)nc1C(=O)OC.
What is the InChIKey of methyl 5-bromo-2-ethyl-1,2,4-triazole-3-carboxylate?
The InChIKey is RZQROLDLPQVCSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8BrN3O2/c1-3-10-4(5(11)12-2)8-6(7)9-10/h3H2,1-2H3.
What are the key properties of methyl 5-bromo-2-ethyl-1,2,4-triazole-3-carboxylate?
methyl 5-bromo-2-ethyl-1,2,4-triazole-3-carboxylate has a molecular weight of 234.05 g/mol, XLogP of 0.85, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-bromo-2-ethyl-1,2,4-triazole-3-carboxylate is sourced from PubChem (CID 154577097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).