C6H8BrN3O2 — CID 154577097
methyl 5-bromo-2-ethyl-1,2,4-triazole-3-carboxylate (PubChem CID 154577097) has the molecular formula C6H8BrN3O2 and a molecular weight of 234.05 g/mol. Its IUPAC name is methyl 5-bromo-2-ethyl-1,2,4-triazole-3-carboxylate.
| Compound Name | methyl 5-bromo-2-ethyl-1,2,4-triazole-3-carboxylate |
|---|---|
| PubChem CID | 154577097 |
| Molecular Formula | C6H8BrN3O2 |
| Molecular Weight | 234.05 g/mol |
| Exact Mass | 232.98 |
| IUPAC Name | methyl 5-bromo-2-ethyl-1,2,4-triazole-3-carboxylate |
| SMILES | CCn1nc(Br)nc1C(=O)OC |
| InChI | InChI=1S/C6H8BrN3O2/c1-3-10-4(5(11)12-2)8-6(7)9-10/h3H2,1-2H3 |
| InChIKey | RZQROLDLPQVCSF-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.05 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |