C6H12N4OS — CID 154577689
[1-methyl-4-(methylsulfonimidoyl)pyrazol-3-yl]methanamine (PubChem CID 154577689) has the molecular formula C6H12N4OS and a molecular weight of 188.26 g/mol. Its IUPAC name is [1-methyl-4-(methylsulfonimidoyl)pyrazol-3-yl]methanamine.
| Compound Name | [1-methyl-4-(methylsulfonimidoyl)pyrazol-3-yl]methanamine |
|---|---|
| PubChem CID | 154577689 |
| Molecular Formula | C6H12N4OS |
| Molecular Weight | 188.26 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | [1-methyl-4-(methylsulfonimidoyl)pyrazol-3-yl]methanamine |
| SMILES | [H]N=S(C)(=O)c1cn(C)nc1CN |
| InChI | InChI=1S/C6H12N4OS/c1-10-4-6(12(2,8)11)5(3-7)9-10/h4,8H,3,7H2,1-2H3 |
| InChIKey | PMMRKNXZMUALMF-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 84.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.26 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |