C20H22N2 — CID 15458747
11-ethyl-1,3,3-trimethyl-4H-pyrido[3,2-a]carbazole (PubChem CID 15458747) has the molecular formula C20H22N2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 11-ethyl-1,3,3-trimethyl-4H-pyrido[3,2-a]carbazole.
| Compound Name | 11-ethyl-1,3,3-trimethyl-4H-pyrido[3,2-a]carbazole |
|---|---|
| PubChem CID | 15458747 |
| Molecular Formula | C20H22N2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | 11-ethyl-1,3,3-trimethyl-4H-pyrido[3,2-a]carbazole |
| SMILES | CCn1c2ccccc2c2ccc3c(c21)C(C)=CC(C)(C)N3 |
| InChI | InChI=1S/C20H22N2/c1-5-22-17-9-7-6-8-14(17)15-10-11-16-18(19(15)22)13(2)12-20(3,4)21-16/h6-12,21H,5H2,1-4H3 |
| InChIKey | XIEIFFBKPGJSCW-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |