C61H47N3O2 — CID 154588967
(Z)-5-hydroxy-1-[2-[3-[2-[4-(1-methylisoquinolin-3-yl)phenyl]phenyl]-5-[2-[4-(4-methylquinazolin-2-yl)phenyl]phenyl]phenyl]phenyl]hex-4-en-3-one (PubChem CID 154588967) has the molecular formula C61H47N3O2 and a molecular weight of 854.07 g/mol. Its IUPAC name is (Z)-5-hydroxy-1-[2-[3-[2-[4-(1-methylisoquinolin-3-yl)phenyl]phenyl]-5-[2-[4-(4-methylquinazolin-2-yl)phenyl]phenyl]phenyl]phenyl]hex-4-en-3-one.
| Compound Name | (Z)-5-hydroxy-1-[2-[3-[2-[4-(1-methylisoquinolin-3-yl)phenyl]phenyl]-5-[2-[4-(4-methylquinazolin-2-yl)phenyl]phenyl]phenyl]phenyl]hex-4-en-3-one |
|---|---|
| PubChem CID | 154588967 |
| Molecular Formula | C61H47N3O2 |
| Molecular Weight | 854.07 g/mol |
| Exact Mass | 853.37 |
| IUPAC Name | (Z)-5-hydroxy-1-[2-[3-[2-[4-(1-methylisoquinolin-3-yl)phenyl]phenyl]-5-[2-[4-(4-methylquinazolin-2-yl)phenyl]phenyl]phenyl]phenyl]hex-4-en-3-one |
| SMILES | C/C(O)=C/C(=O)CCc1ccccc1-c1cc(-c2ccccc2-c2ccc(-c3cc4ccccc4c(C)n3)cc2)cc(-c2ccccc2-c2ccc(-c3nc(C)c4ccccc4n3)cc2)c1 |
| InChI | InChI=1S/C61H47N3O2/c1-39(65)34-51(66)33-32-42-14-4-7-18-54(42)48-35-49(57-21-10-8-19-55(57)43-24-28-45(29-25-43)60-38-47-15-5-6-16-52(47)40(2)62-60)37-50(36-48)58-22-11-9-20-56(58)44-26-30-46(31-27-44)61-63-41(3)53-17-12-13-23-59(53)64-61/h4-31,34-38,65H,32-33H2,1-3H3/b39-34- |
| InChIKey | IWBIBQWJRDUFFS-RSHGFABKSA-N |
| XLogP | 15.43 |
| TPSA | 75.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 854.07 |
| LogP ≤ 5 | 15.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|