C20H36O2Si — CID 15459009
tert-butyl-[(5S)-1-methoxytrideca-2,3-dien-7-yn-5-yl]oxy-dimethylsilane (PubChem CID 15459009) has the molecular formula C20H36O2Si and a molecular weight of 336.59 g/mol. Its IUPAC name is tert-butyl-[(5S)-1-methoxytrideca-2,3-dien-7-yn-5-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(5S)-1-methoxytrideca-2,3-dien-7-yn-5-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 15459009 |
| Molecular Formula | C20H36O2Si |
| Molecular Weight | 336.59 g/mol |
| Exact Mass | 336.25 |
| IUPAC Name | tert-butyl-[(5S)-1-methoxytrideca-2,3-dien-7-yn-5-yl]oxy-dimethylsilane |
| SMILES | CCCCCC#CC[C@@H](C=C=CCOC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H36O2Si/c1-8-9-10-11-12-13-16-19(17-14-15-18-21-5)22-23(6,7)20(2,3)4/h15,17,19H,8-11,16,18H2,1-7H3/t14?,19-/m0/s1 |
| InChIKey | CUIAULCVCKNPIO-PKDNWHCCSA-N |
| XLogP | 5.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.59 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|