C20H23O4P — CID 154591744
4-octyl-5-phenyl-2,9,10-trioxa-1λ5-phosphatricyclo[5.2.1.03,8]deca-3,5,7-triene 1-oxide (PubChem CID 154591744) has the molecular formula C20H23O4P and a molecular weight of 358.37 g/mol. Its IUPAC name is 4-octyl-5-phenyl-2,9,10-trioxa-1λ5-phosphatricyclo[5.2.1.03,8]deca-3,5,7-triene 1-oxide.
| Compound Name | 4-octyl-5-phenyl-2,9,10-trioxa-1λ5-phosphatricyclo[5.2.1.03,8]deca-3,5,7-triene 1-oxide |
|---|---|
| PubChem CID | 154591744 |
| Molecular Formula | C20H23O4P |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 4-octyl-5-phenyl-2,9,10-trioxa-1λ5-phosphatricyclo[5.2.1.03,8]deca-3,5,7-triene 1-oxide |
| SMILES | CCCCCCCCc1c(-c2ccccc2)cc2c3c1OP(=O)(O2)O3 |
| InChI | InChI=1S/C20H23O4P/c1-2-3-4-5-6-10-13-16-17(15-11-8-7-9-12-15)14-18-20-19(16)23-25(21,22-18)24-20/h7-9,11-12,14H,2-6,10,13H2,1H3 |
| InChIKey | JCXMGHDKCNIRMK-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|