C33H34F6O6S3 — CID 154594493
3-[4-bis(4-cyclohexylphenyl)sulfoniophenoxy]sulfonyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonate (PubChem CID 154594493) has the molecular formula C33H34F6O6S3 and a molecular weight of 736.82 g/mol. Its IUPAC name is 3-[4-bis(4-cyclohexylphenyl)sulfoniophenoxy]sulfonyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonate.
| Compound Name | 3-[4-bis(4-cyclohexylphenyl)sulfoniophenoxy]sulfonyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonate |
|---|---|
| PubChem CID | 154594493 |
| Molecular Formula | C33H34F6O6S3 |
| Molecular Weight | 736.82 g/mol |
| Exact Mass | 736.14 |
| IUPAC Name | 3-[4-bis(4-cyclohexylphenyl)sulfoniophenoxy]sulfonyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)Oc1ccc([S+](c2ccc(C3CCCCC3)cc2)c2ccc(C3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C33H34F6O6S3/c34-31(35,32(36,37)47(40,41)42)33(38,39)48(43,44)45-27-15-21-30(22-16-27)46(28-17-11-25(12-18-28)23-7-3-1-4-8-23)29-19-13-26(14-20-29)24-9-5-2-6-10-24/h11-24H,1-10H2 |
| InChIKey | YBWPULUGYLKCBE-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 100.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.82 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|