C24H43N7O8S — CID 154597584
3-N-[5-[(2-azidoacetyl)amino]pentyl]-5-N-[2-[(2,2-dioxooxathiolan-3-yl)methoxy]ethyl]-1-methylheptane-1,3,5-tricarboxamide (PubChem CID 154597584) has the molecular formula C24H43N7O8S and a molecular weight of 589.72 g/mol. Its IUPAC name is 3-N-[5-[(2-azidoacetyl)amino]pentyl]-5-N-[2-[(2,2-dioxooxathiolan-3-yl)methoxy]ethyl]-1-methylheptane-1,3,5-tricarboxamide.
| Compound Name | 3-N-[5-[(2-azidoacetyl)amino]pentyl]-5-N-[2-[(2,2-dioxooxathiolan-3-yl)methoxy]ethyl]-1-methylheptane-1,3,5-tricarboxamide |
|---|---|
| PubChem CID | 154597584 |
| Molecular Formula | C24H43N7O8S |
| Molecular Weight | 589.72 g/mol |
| Exact Mass | 589.29 |
| IUPAC Name | 3-N-[5-[(2-azidoacetyl)amino]pentyl]-5-N-[2-[(2,2-dioxooxathiolan-3-yl)methoxy]ethyl]-1-methylheptane-1,3,5-tricarboxamide |
| SMILES | CCC(CC(CC(C)C(N)=O)C(=O)NCCCCCNC(=O)CN=[N+]=[N-])C(=O)NCCOCC1CCOS1(=O)=O |
| InChI | InChI=1S/C24H43N7O8S/c1-3-18(23(34)29-10-12-38-16-20-7-11-39-40(20,36)37)14-19(13-17(2)22(25)33)24(35)28-9-6-4-5-8-27-21(32)15-30-31-26/h17-20H,3-16H2,1-2H3,(H2,25,33)(H,27,32)(H,28,35)(H,29,34) |
| InChIKey | YKYZHPHMIOWZES-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 231.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.72 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|