C24H38BN7O6 — CID 154597594
[3-[[7-amino-4-[5-[(2-azidoacetyl)amino]pentylcarbamoyl]-2-ethyl-6-methyl-7-oxoheptanoyl]amino]phenyl]boronic acid (PubChem CID 154597594) has the molecular formula C24H38BN7O6 and a molecular weight of 531.42 g/mol. Its IUPAC name is [3-[[7-amino-4-[5-[(2-azidoacetyl)amino]pentylcarbamoyl]-2-ethyl-6-methyl-7-oxoheptanoyl]amino]phenyl]boronic acid.
| Compound Name | [3-[[7-amino-4-[5-[(2-azidoacetyl)amino]pentylcarbamoyl]-2-ethyl-6-methyl-7-oxoheptanoyl]amino]phenyl]boronic acid |
|---|---|
| PubChem CID | 154597594 |
| Molecular Formula | C24H38BN7O6 |
| Molecular Weight | 531.42 g/mol |
| Exact Mass | 531.30 |
| IUPAC Name | [3-[[7-amino-4-[5-[(2-azidoacetyl)amino]pentylcarbamoyl]-2-ethyl-6-methyl-7-oxoheptanoyl]amino]phenyl]boronic acid |
| SMILES | CCC(CC(CC(C)C(N)=O)C(=O)NCCCCCNC(=O)CN=[N+]=[N-])C(=O)Nc1cccc(B(O)O)c1 |
| InChI | InChI=1S/C24H38BN7O6/c1-3-17(24(36)31-20-9-7-8-19(14-20)25(37)38)13-18(12-16(2)22(26)34)23(35)29-11-6-4-5-10-28-21(33)15-30-32-27/h7-9,14,16-18,37-38H,3-6,10-13,15H2,1-2H3,(H2,26,34)(H,28,33)(H,29,35)(H,31,36) |
| InChIKey | FPXNKTFPSBYMID-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 219.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.42 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|