C19H19ClN2O3 — CID 154598009
benzyl N-[(2R,3S,4S)-2-(2-chlorophenyl)-4-methyl-5-oxopyrrolidin-3-yl]carbamate (PubChem CID 154598009) has the molecular formula C19H19ClN2O3 and a molecular weight of 358.83 g/mol. Its IUPAC name is benzyl N-[(2R,3S,4S)-2-(2-chlorophenyl)-4-methyl-5-oxopyrrolidin-3-yl]carbamate.
| Compound Name | benzyl N-[(2R,3S,4S)-2-(2-chlorophenyl)-4-methyl-5-oxopyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 154598009 |
| Molecular Formula | C19H19ClN2O3 |
| Molecular Weight | 358.83 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | benzyl N-[(2R,3S,4S)-2-(2-chlorophenyl)-4-methyl-5-oxopyrrolidin-3-yl]carbamate |
| SMILES | C[C@@H]1C(=O)N[C@H](c2ccccc2Cl)[C@H]1NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H19ClN2O3/c1-12-16(22-19(24)25-11-13-7-3-2-4-8-13)17(21-18(12)23)14-9-5-6-10-15(14)20/h2-10,12,16-17H,11H2,1H3,(H,21,23)(H,22,24)/t12-,16-,17+/m0/s1 |
| InChIKey | XYSPGNWOUAXRLU-AFAVFJNCSA-N |
| XLogP | 3.44 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.83 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |