C17H17ClN2O3S — CID 154598095
benzyl N-[2-(5-chlorothiophen-2-yl)-4-methyl-5-oxopyrrolidin-3-yl]carbamate (PubChem CID 154598095) has the molecular formula C17H17ClN2O3S and a molecular weight of 364.85 g/mol. Its IUPAC name is benzyl N-[2-(5-chlorothiophen-2-yl)-4-methyl-5-oxopyrrolidin-3-yl]carbamate.
| Compound Name | benzyl N-[2-(5-chlorothiophen-2-yl)-4-methyl-5-oxopyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 154598095 |
| Molecular Formula | C17H17ClN2O3S |
| Molecular Weight | 364.85 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | benzyl N-[2-(5-chlorothiophen-2-yl)-4-methyl-5-oxopyrrolidin-3-yl]carbamate |
| SMILES | CC1C(=O)NC(c2ccc(Cl)s2)C1NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H17ClN2O3S/c1-10-14(15(19-16(10)21)12-7-8-13(18)24-12)20-17(22)23-9-11-5-3-2-4-6-11/h2-8,10,14-15H,9H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | GPDQRGTXHKXRSZ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.85 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |