C45H53F3IrNO2- — CID 154599251
2-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-5,7-dimethyl-4-spiro[4.5]decan-8-ylquinoline;(Z)-1-cyclohexyl-4,4,4-trifluoro-3-hydroxybut-2-en-1-one;iridium (PubChem CID 154599251) has the molecular formula C45H53F3IrNO2- and a molecular weight of 889.13 g/mol. Its IUPAC name is 2-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-5,7-dimethyl-4-spiro[4.5]decan-8-ylquinoline;(Z)-1-cyclohexyl-4,4,4-trifluoro-3-hydroxybut-2-en-1-one;iridium.
| Compound Name | 2-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-5,7-dimethyl-4-spiro[4.5]decan-8-ylquinoline;(Z)-1-cyclohexyl-4,4,4-trifluoro-3-hydroxybut-2-en-1-one;iridium |
|---|---|
| PubChem CID | 154599251 |
| Molecular Formula | C45H53F3IrNO2- |
| Molecular Weight | 889.13 g/mol |
| Exact Mass | 889.37 |
| IUPAC Name | 2-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-5,7-dimethyl-4-spiro[4.5]decan-8-ylquinoline;(Z)-1-cyclohexyl-4,4,4-trifluoro-3-hydroxybut-2-en-1-one;iridium |
| SMILES | Cc1cc(C)c2c(C3CCC4(CCCC4)CC3)cc(-c3[c-]c4ccccc4c(C(C)(C)C)c3)nc2c1.O=C(/C=C(\O)C(F)(F)F)C1CCCCC1.[Ir] |
| InChI | InChI=1S/C35H40N.C10H13F3O2.Ir/c1-23-18-24(2)33-29(25-12-16-35(17-13-25)14-8-9-15-35)22-31(36-32(33)19-23)27-20-26-10-6-7-11-28(26)30(21-27)34(3,4)5;11-10(12,13)9(15)6-8(14)7-4-2-1-3-5-7;/h6-7,10-11,18-19,21-22,25H,8-9,12-17H2,1-5H3;6-7,15H,1-5H2;/q-1;;/b;9-6-; |
| InChIKey | GHJXQLTYXQYWHV-FIOJASIISA-N |
| XLogP | 13.13 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 889.13 |
| LogP ≤ 5 | 13.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|