C37H23N3Pt — CID 154599696
CID 154599696 (PubChem CID 154599696) has the molecular formula C37H23N3Pt and a molecular weight of 704.69 g/mol.
| Compound Name | CID 154599696 |
|---|---|
| PubChem CID | 154599696 |
| Molecular Formula | C37H23N3Pt |
| Molecular Weight | 704.69 g/mol |
| Exact Mass | 704.15 |
| IUPAC Name | — |
| SMILES | [Pt+2].[c-]1c(-c2ccccn2)ccc2c1C(c1[c-]c3c(cc1)c1ccccc1n3-c1ccccn1)c1ccccc1C=C2 |
| InChI | InChI=1S/C37H23N3.Pt/c1-2-10-29-25(9-1)15-16-26-17-18-27(33-12-5-7-21-38-33)23-32(26)37(29)28-19-20-31-30-11-3-4-13-34(30)40(35(31)24-28)36-14-6-8-22-39-36;/h1-22,37H;/q-2;+2 |
| InChIKey | SGHTZKJKRDRDMO-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.69 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|