C10H10BrClN4O — CID 154606656
1-[(E)-4-bromobut-2-enyl]-5-chloro-7-methoxypyrazolo[4,5-d]pyrimidine (PubChem CID 154606656) has the molecular formula C10H10BrClN4O and a molecular weight of 317.57 g/mol. Its IUPAC name is 1-[(E)-4-bromobut-2-enyl]-5-chloro-7-methoxypyrazolo[4,5-d]pyrimidine.
| Compound Name | 1-[(E)-4-bromobut-2-enyl]-5-chloro-7-methoxypyrazolo[4,5-d]pyrimidine |
|---|---|
| PubChem CID | 154606656 |
| Molecular Formula | C10H10BrClN4O |
| Molecular Weight | 317.57 g/mol |
| Exact Mass | 315.97 |
| IUPAC Name | 1-[(E)-4-bromobut-2-enyl]-5-chloro-7-methoxypyrazolo[4,5-d]pyrimidine |
| SMILES | COc1nc(Cl)nc2cnn(C/C=C/CBr)c12 |
| InChI | InChI=1S/C10H10BrClN4O/c1-17-9-8-7(14-10(12)15-9)6-13-16(8)5-3-2-4-11/h2-3,6H,4-5H2,1H3/b3-2+ |
| InChIKey | HANGOSXFLHXUMM-NSCUHMNNSA-N |
| XLogP | 2.44 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.57 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|