C15H21ClN4O4 — CID 154606637
5-chloro-7-(2-methoxyethoxy)-1-[(E)-4-(2-methoxyethoxy)but-2-enyl]pyrazolo[4,5-d]pyrimidine (PubChem CID 154606637) has the molecular formula C15H21ClN4O4 and a molecular weight of 356.81 g/mol. Its IUPAC name is 5-chloro-7-(2-methoxyethoxy)-1-[(E)-4-(2-methoxyethoxy)but-2-enyl]pyrazolo[4,5-d]pyrimidine.
| Compound Name | 5-chloro-7-(2-methoxyethoxy)-1-[(E)-4-(2-methoxyethoxy)but-2-enyl]pyrazolo[4,5-d]pyrimidine |
|---|---|
| PubChem CID | 154606637 |
| Molecular Formula | C15H21ClN4O4 |
| Molecular Weight | 356.81 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 5-chloro-7-(2-methoxyethoxy)-1-[(E)-4-(2-methoxyethoxy)but-2-enyl]pyrazolo[4,5-d]pyrimidine |
| SMILES | COCCOC/C=C/Cn1ncc2nc(Cl)nc(OCCOC)c21 |
| InChI | InChI=1S/C15H21ClN4O4/c1-21-7-9-23-6-4-3-5-20-13-12(11-17-20)18-15(16)19-14(13)24-10-8-22-2/h3-4,11H,5-10H2,1-2H3/b4-3+ |
| InChIKey | SBWRQAZXRYDAPU-ONEGZZNKSA-N |
| XLogP | 1.72 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.81 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|