C9H9BrClN3O2 — CID 155476000
5-bromo-2-chloro-4-(2-methoxyethoxy)-7H-pyrrolo[2,3-d]pyrimidine (PubChem CID 155476000) has the molecular formula C9H9BrClN3O2 and a molecular weight of 306.55 g/mol. Its IUPAC name is 5-bromo-2-chloro-4-(2-methoxyethoxy)-7H-pyrrolo[2,3-d]pyrimidine.
| Compound Name | 5-bromo-2-chloro-4-(2-methoxyethoxy)-7H-pyrrolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 155476000 |
| Molecular Formula | C9H9BrClN3O2 |
| Molecular Weight | 306.55 g/mol |
| Exact Mass | 304.96 |
| IUPAC Name | 5-bromo-2-chloro-4-(2-methoxyethoxy)-7H-pyrrolo[2,3-d]pyrimidine |
| SMILES | COCCOc1nc(Cl)nc2[nH]cc(Br)c12 |
| InChI | InChI=1S/C9H9BrClN3O2/c1-15-2-3-16-8-6-5(10)4-12-7(6)13-9(11)14-8/h4H,2-3H2,1H3,(H,12,13,14) |
| InChIKey | ITXJYRIHCJPLET-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.55 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|