C9H10BrN3O2S — CID 59352792
6-bromo-5-(2-methoxyethoxy)-[1,3]thiazolo[5,4-b]pyridin-2-amine (PubChem CID 59352792) has the molecular formula C9H10BrN3O2S and a molecular weight of 304.17 g/mol. Its IUPAC name is 6-bromo-5-(2-methoxyethoxy)-[1,3]thiazolo[5,4-b]pyridin-2-amine.
| Compound Name | 6-bromo-5-(2-methoxyethoxy)-[1,3]thiazolo[5,4-b]pyridin-2-amine |
|---|---|
| PubChem CID | 59352792 |
| Molecular Formula | C9H10BrN3O2S |
| Molecular Weight | 304.17 g/mol |
| Exact Mass | 302.97 |
| IUPAC Name | 6-bromo-5-(2-methoxyethoxy)-[1,3]thiazolo[5,4-b]pyridin-2-amine |
| SMILES | COCCOc1nc2sc(N)nc2cc1Br |
| InChI | InChI=1S/C9H10BrN3O2S/c1-14-2-3-15-7-5(10)4-6-8(13-7)16-9(11)12-6/h4H,2-3H2,1H3,(H2,11,12) |
| InChIKey | DYFXGAOFIFANPF-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.17 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|