C22H21ClN4O2S — CID 154608696
3-[(3R,4R)-4-benzyl-1-(2-chloropyrimidin-4-yl)-5-oxopyrrolidin-3-yl]-3-oxo-2-(thiolan-1-ylidene)propanenitrile (PubChem CID 154608696) has the molecular formula C22H21ClN4O2S and a molecular weight of 440.96 g/mol. Its IUPAC name is 3-[(3R,4R)-4-benzyl-1-(2-chloropyrimidin-4-yl)-5-oxopyrrolidin-3-yl]-3-oxo-2-(thiolan-1-ylidene)propanenitrile.
| Compound Name | 3-[(3R,4R)-4-benzyl-1-(2-chloropyrimidin-4-yl)-5-oxopyrrolidin-3-yl]-3-oxo-2-(thiolan-1-ylidene)propanenitrile |
|---|---|
| PubChem CID | 154608696 |
| Molecular Formula | C22H21ClN4O2S |
| Molecular Weight | 440.96 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | 3-[(3R,4R)-4-benzyl-1-(2-chloropyrimidin-4-yl)-5-oxopyrrolidin-3-yl]-3-oxo-2-(thiolan-1-ylidene)propanenitrile |
| SMILES | N#CC(C(=O)[C@H]1CN(c2ccnc(Cl)n2)C(=O)[C@@H]1Cc1ccccc1)=S1CCCC1 |
| InChI | InChI=1S/C22H21ClN4O2S/c23-22-25-9-8-19(26-22)27-14-17(20(28)18(13-24)30-10-4-5-11-30)16(21(27)29)12-15-6-2-1-3-7-15/h1-3,6-9,16-17H,4-5,10-12,14H2/t16-,17+/m1/s1 |
| InChIKey | HOPTZCNSDPJMJY-SJORKVTESA-N |
| XLogP | 3.28 |
| TPSA | 86.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.96 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|