C32H39F5O7S2 — CID 154615080
[1,1,1,3,3-pentafluoro-3-[1-[4-(2-methoxyethoxy)naphthalen-1-yl]thian-1-yl]oxysulfonylpropan-2-yl] adamantane-1-carboxylate (PubChem CID 154615080) has the molecular formula C32H39F5O7S2 and a molecular weight of 694.78 g/mol. Its IUPAC name is [1,1,1,3,3-pentafluoro-3-[1-[4-(2-methoxyethoxy)naphthalen-1-yl]thian-1-yl]oxysulfonylpropan-2-yl] adamantane-1-carboxylate.
| Compound Name | [1,1,1,3,3-pentafluoro-3-[1-[4-(2-methoxyethoxy)naphthalen-1-yl]thian-1-yl]oxysulfonylpropan-2-yl] adamantane-1-carboxylate |
|---|---|
| PubChem CID | 154615080 |
| Molecular Formula | C32H39F5O7S2 |
| Molecular Weight | 694.78 g/mol |
| Exact Mass | 694.21 |
| IUPAC Name | [1,1,1,3,3-pentafluoro-3-[1-[4-(2-methoxyethoxy)naphthalen-1-yl]thian-1-yl]oxysulfonylpropan-2-yl] adamantane-1-carboxylate |
| SMILES | COCCOc1ccc(S2(OS(=O)(=O)C(F)(F)C(OC(=O)C34CC5CC(CC(C5)C3)C4)C(F)(F)F)CCCCC2)c2ccccc12 |
| InChI | InChI=1S/C32H39F5O7S2/c1-41-11-12-42-26-9-10-27(25-8-4-3-7-24(25)26)45(13-5-2-6-14-45)44-46(39,40)32(36,37)28(31(33,34)35)43-29(38)30-18-21-15-22(19-30)17-23(16-21)20-30/h3-4,7-10,21-23,28H,2,5-6,11-20H2,1H3 |
| InChIKey | GLAXANVOGBJAKR-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.78 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|