C10H12N2O6 — CID 154618540
2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-3-hydroxybutanoic acid (PubChem CID 154618540) has the molecular formula C10H12N2O6 and a molecular weight of 256.21 g/mol. Its IUPAC name is 2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-3-hydroxybutanoic acid.
| Compound Name | 2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 154618540 |
| Molecular Formula | C10H12N2O6 |
| Molecular Weight | 256.21 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-3-hydroxybutanoic acid |
| SMILES | CC(O)C(NC(=O)CN1C(=O)C=CC1=O)C(=O)O |
| InChI | InChI=1S/C10H12N2O6/c1-5(13)9(10(17)18)11-6(14)4-12-7(15)2-3-8(12)16/h2-3,5,9,13H,4H2,1H3,(H,11,14)(H,17,18) |
| InChIKey | DDCNWHHDUFNPTK-UHFFFAOYSA-N |
| XLogP | -2.14 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.21 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|