C21H19N3O2 — CID 154620538
(13aS)-2-isocyano-3,9-dimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline-10-carbonitrile (PubChem CID 154620538) has the molecular formula C21H19N3O2 and a molecular weight of 345.40 g/mol. Its IUPAC name is (13aS)-2-isocyano-3,9-dimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline-10-carbonitrile.
| Compound Name | (13aS)-2-isocyano-3,9-dimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline-10-carbonitrile |
|---|---|
| PubChem CID | 154620538 |
| Molecular Formula | C21H19N3O2 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | (13aS)-2-isocyano-3,9-dimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline-10-carbonitrile |
| SMILES | [C-]#[N+]c1cc2c(cc1OC)CCN1Cc3c(ccc(C#N)c3OC)C[C@@H]21 |
| InChI | InChI=1S/C21H19N3O2/c1-23-18-10-16-14(9-20(18)25-2)6-7-24-12-17-13(8-19(16)24)4-5-15(11-22)21(17)26-3/h4-5,9-10,19H,6-8,12H2,2-3H3/t19-/m0/s1 |
| InChIKey | DQQOMPPOHSUFDY-IBGZPJMESA-N |
| XLogP | 3.78 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|