C36H25F5N2O2 — CID 15462158
(2,3,4,5,6-pentafluorophenyl) (2S)-2,6-di(carbazol-9-yl)hexanoate (PubChem CID 15462158) has the molecular formula C36H25F5N2O2 and a molecular weight of 612.60 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) (2S)-2,6-di(carbazol-9-yl)hexanoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) (2S)-2,6-di(carbazol-9-yl)hexanoate |
|---|---|
| PubChem CID | 15462158 |
| Molecular Formula | C36H25F5N2O2 |
| Molecular Weight | 612.60 g/mol |
| Exact Mass | 612.18 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) (2S)-2,6-di(carbazol-9-yl)hexanoate |
| SMILES | O=C(Oc1c(F)c(F)c(F)c(F)c1F)[C@H](CCCCn1c2ccccc2c2ccccc21)n1c2ccccc2c2ccccc21 |
| InChI | InChI=1S/C36H25F5N2O2/c37-30-31(38)33(40)35(34(41)32(30)39)45-36(44)29(43-27-17-7-3-13-23(27)24-14-4-8-18-28(24)43)19-9-10-20-42-25-15-5-1-11-21(25)22-12-2-6-16-26(22)42/h1-8,11-18,29H,9-10,19-20H2/t29-/m0/s1 |
| InChIKey | DVUMJQKHBBIDPS-LJAQVGFWSA-N |
| XLogP | 9.62 |
| TPSA | 36.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.60 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|