C26H27N3O3 — CID 67993117
methyl (2S)-6-[(4-aminobenzoyl)amino]-2-carbazol-9-ylhexanoate (PubChem CID 67993117) has the molecular formula C26H27N3O3 and a molecular weight of 429.52 g/mol. Its IUPAC name is methyl (2S)-6-[(4-aminobenzoyl)amino]-2-carbazol-9-ylhexanoate.
| Compound Name | methyl (2S)-6-[(4-aminobenzoyl)amino]-2-carbazol-9-ylhexanoate |
|---|---|
| PubChem CID | 67993117 |
| Molecular Formula | C26H27N3O3 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | methyl (2S)-6-[(4-aminobenzoyl)amino]-2-carbazol-9-ylhexanoate |
| SMILES | COC(=O)[C@H](CCCCNC(=O)c1ccc(N)cc1)n1c2ccccc2c2ccccc21 |
| InChI | InChI=1S/C26H27N3O3/c1-32-26(31)24(12-6-7-17-28-25(30)18-13-15-19(27)16-14-18)29-22-10-4-2-8-20(22)21-9-3-5-11-23(21)29/h2-5,8-11,13-16,24H,6-7,12,17,27H2,1H3,(H,28,30)/t24-/m0/s1 |
| InChIKey | MRXZSYGWLOCWKB-DEOSSOPVSA-N |
| XLogP | 4.69 |
| TPSA | 86.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|