C9H10N2O — CID 154624191
1-[(1R,2R)-2-pyrimidin-5-ylcyclopropyl]ethanone (PubChem CID 154624191) has the molecular formula C9H10N2O and a molecular weight of 162.19 g/mol. Its IUPAC name is 1-[(1R,2R)-2-pyrimidin-5-ylcyclopropyl]ethanone.
| Compound Name | 1-[(1R,2R)-2-pyrimidin-5-ylcyclopropyl]ethanone |
|---|---|
| PubChem CID | 154624191 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 1-[(1R,2R)-2-pyrimidin-5-ylcyclopropyl]ethanone |
| SMILES | CC(=O)[C@@H]1C[C@H]1c1cncnc1 |
| InChI | InChI=1S/C9H10N2O/c1-6(12)8-2-9(8)7-3-10-5-11-4-7/h3-5,8-9H,2H2,1H3/t8-,9-/m0/s1 |
| InChIKey | XYWZDCWFXGGIPY-IUCAKERBSA-N |
| XLogP | 1.17 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |