C16H19Cl2N3O — CID 154631731
3-(3,4-dichlorophenyl)-5-(4-pyrrolidin-1-ylbutyl)-1,2,4-oxadiazole (PubChem CID 154631731) has the molecular formula C16H19Cl2N3O and a molecular weight of 340.25 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-5-(4-pyrrolidin-1-ylbutyl)-1,2,4-oxadiazole.
| Compound Name | 3-(3,4-dichlorophenyl)-5-(4-pyrrolidin-1-ylbutyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 154631731 |
| Molecular Formula | C16H19Cl2N3O |
| Molecular Weight | 340.25 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-5-(4-pyrrolidin-1-ylbutyl)-1,2,4-oxadiazole |
| SMILES | Clc1ccc(-c2noc(CCCCN3CCCC3)n2)cc1Cl |
| InChI | InChI=1S/C16H19Cl2N3O/c17-13-7-6-12(11-14(13)18)16-19-15(22-20-16)5-1-2-8-21-9-3-4-10-21/h6-7,11H,1-5,8-10H2 |
| InChIKey | PWNOPAILFNTKBR-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 42.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.25 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|