C18H18Cl2N4O4 — CID 90330482
N-[4-[3-(3,4-dichlorophenyl)-1,2,4-oxadiazol-5-yl]butyl]-4-hydroxy-1-methyl-5-oxo-2H-pyrrole-3-carboxamide (PubChem CID 90330482) has the molecular formula C18H18Cl2N4O4 and a molecular weight of 425.27 g/mol. Its IUPAC name is N-[4-[3-(3,4-dichlorophenyl)-1,2,4-oxadiazol-5-yl]butyl]-4-hydroxy-1-methyl-5-oxo-2H-pyrrole-3-carboxamide.
| Compound Name | N-[4-[3-(3,4-dichlorophenyl)-1,2,4-oxadiazol-5-yl]butyl]-4-hydroxy-1-methyl-5-oxo-2H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 90330482 |
| Molecular Formula | C18H18Cl2N4O4 |
| Molecular Weight | 425.27 g/mol |
| Exact Mass | 424.07 |
| IUPAC Name | N-[4-[3-(3,4-dichlorophenyl)-1,2,4-oxadiazol-5-yl]butyl]-4-hydroxy-1-methyl-5-oxo-2H-pyrrole-3-carboxamide |
| SMILES | CN1CC(C(=O)NCCCCc2nc(-c3ccc(Cl)c(Cl)c3)no2)=C(O)C1=O |
| InChI | InChI=1S/C18H18Cl2N4O4/c1-24-9-11(15(25)18(24)27)17(26)21-7-3-2-4-14-22-16(23-28-14)10-5-6-12(19)13(20)8-10/h5-6,8,25H,2-4,7,9H2,1H3,(H,21,26) |
| InChIKey | KIACOTSLFIEPOY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.27 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|