C18H14N4O2 — CID 154631889
N'-[(E)-naphthalen-2-ylmethylideneamino]-N-pyridin-3-yloxamide (PubChem CID 154631889) has the molecular formula C18H14N4O2 and a molecular weight of 318.34 g/mol. Its IUPAC name is N'-[(E)-naphthalen-2-ylmethylideneamino]-N-pyridin-3-yloxamide.
| Compound Name | N'-[(E)-naphthalen-2-ylmethylideneamino]-N-pyridin-3-yloxamide |
|---|---|
| PubChem CID | 154631889 |
| Molecular Formula | C18H14N4O2 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | N'-[(E)-naphthalen-2-ylmethylideneamino]-N-pyridin-3-yloxamide |
| SMILES | O=C(N/N=C/c1ccc2ccccc2c1)C(=O)Nc1cccnc1 |
| InChI | InChI=1S/C18H14N4O2/c23-17(21-16-6-3-9-19-12-16)18(24)22-20-11-13-7-8-14-4-1-2-5-15(14)10-13/h1-12H,(H,21,23)(H,22,24)/b20-11+ |
| InChIKey | GRMICMOHZDYWLZ-RGVLZGJSSA-N |
| XLogP | 2.32 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|