C14H13N5O4S — CID 6900209
N'-[(E)-pyridin-3-ylmethylideneamino]-N-(4-sulfamoylphenyl)oxamide (PubChem CID 6900209) has the molecular formula C14H13N5O4S and a molecular weight of 347.36 g/mol. Its IUPAC name is N'-[(E)-pyridin-3-ylmethylideneamino]-N-(4-sulfamoylphenyl)oxamide.
| Compound Name | N'-[(E)-pyridin-3-ylmethylideneamino]-N-(4-sulfamoylphenyl)oxamide |
|---|---|
| PubChem CID | 6900209 |
| Molecular Formula | C14H13N5O4S |
| Molecular Weight | 347.36 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | N'-[(E)-pyridin-3-ylmethylideneamino]-N-(4-sulfamoylphenyl)oxamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)C(=O)N/N=C/c2cccnc2)cc1 |
| InChI | InChI=1S/C14H13N5O4S/c15-24(22,23)12-5-3-11(4-6-12)18-13(20)14(21)19-17-9-10-2-1-7-16-8-10/h1-9H,(H,18,20)(H,19,21)(H2,15,22,23)/b17-9+ |
| InChIKey | NYOQJQAEBSEUJV-RQZCQDPDSA-N |
| XLogP | -0.18 |
| TPSA | 143.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.36 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|