C31H37FN6O — CID 154632885
6-(3-fluoro-4-pyridinyl)-3-methyl-2-[7-[(6-methyl-1,2,3,4-tetrahydroacridin-9-yl)amino]heptylamino]pyrimidin-4-one (PubChem CID 154632885) has the molecular formula C31H37FN6O and a molecular weight of 528.68 g/mol. Its IUPAC name is 6-(3-fluoro-4-pyridinyl)-3-methyl-2-[7-[(6-methyl-1,2,3,4-tetrahydroacridin-9-yl)amino]heptylamino]pyrimidin-4-one.
| Compound Name | 6-(3-fluoro-4-pyridinyl)-3-methyl-2-[7-[(6-methyl-1,2,3,4-tetrahydroacridin-9-yl)amino]heptylamino]pyrimidin-4-one |
|---|---|
| PubChem CID | 154632885 |
| Molecular Formula | C31H37FN6O |
| Molecular Weight | 528.68 g/mol |
| Exact Mass | 528.30 |
| IUPAC Name | 6-(3-fluoro-4-pyridinyl)-3-methyl-2-[7-[(6-methyl-1,2,3,4-tetrahydroacridin-9-yl)amino]heptylamino]pyrimidin-4-one |
| SMILES | Cc1ccc2c(NCCCCCCCNc3nc(-c4ccncc4F)cc(=O)n3C)c3c(nc2c1)CCCC3 |
| InChI | InChI=1S/C31H37FN6O/c1-21-12-13-24-27(18-21)36-26-11-7-6-10-23(26)30(24)34-15-8-4-3-5-9-16-35-31-37-28(19-29(39)38(31)2)22-14-17-33-20-25(22)32/h12-14,17-20H,3-11,15-16H2,1-2H3,(H,34,36)(H,35,37) |
| InChIKey | ZPZRWFFWKSZVFN-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.68 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|