C30H36N6O — CID 154632881
3-methyl-6-pyridin-4-yl-2-[7-(1,2,3,4-tetrahydroacridin-9-ylamino)heptylamino]pyrimidin-4-one (PubChem CID 154632881) has the molecular formula C30H36N6O and a molecular weight of 496.66 g/mol. Its IUPAC name is 3-methyl-6-pyridin-4-yl-2-[7-(1,2,3,4-tetrahydroacridin-9-ylamino)heptylamino]pyrimidin-4-one.
| Compound Name | 3-methyl-6-pyridin-4-yl-2-[7-(1,2,3,4-tetrahydroacridin-9-ylamino)heptylamino]pyrimidin-4-one |
|---|---|
| PubChem CID | 154632881 |
| Molecular Formula | C30H36N6O |
| Molecular Weight | 496.66 g/mol |
| Exact Mass | 496.30 |
| IUPAC Name | 3-methyl-6-pyridin-4-yl-2-[7-(1,2,3,4-tetrahydroacridin-9-ylamino)heptylamino]pyrimidin-4-one |
| SMILES | Cn1c(NCCCCCCCNc2c3c(nc4ccccc24)CCCC3)nc(-c2ccncc2)cc1=O |
| InChI | InChI=1S/C30H36N6O/c1-36-28(37)21-27(22-15-19-31-20-16-22)35-30(36)33-18-10-4-2-3-9-17-32-29-23-11-5-7-13-25(23)34-26-14-8-6-12-24(26)29/h5,7,11,13,15-16,19-21H,2-4,6,8-10,12,14,17-18H2,1H3,(H,32,34)(H,33,35) |
| InChIKey | LPTPYXDNJGZBRM-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.66 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|