C25H25FN6O — CID 154632925
2-[2-[(7-fluoro-1,2,3,4-tetrahydroacridin-9-yl)amino]ethylamino]-3-methyl-6-pyridin-4-ylpyrimidin-4-one (PubChem CID 154632925) has the molecular formula C25H25FN6O and a molecular weight of 444.51 g/mol. Its IUPAC name is 2-[2-[(7-fluoro-1,2,3,4-tetrahydroacridin-9-yl)amino]ethylamino]-3-methyl-6-pyridin-4-ylpyrimidin-4-one.
| Compound Name | 2-[2-[(7-fluoro-1,2,3,4-tetrahydroacridin-9-yl)amino]ethylamino]-3-methyl-6-pyridin-4-ylpyrimidin-4-one |
|---|---|
| PubChem CID | 154632925 |
| Molecular Formula | C25H25FN6O |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | 2-[2-[(7-fluoro-1,2,3,4-tetrahydroacridin-9-yl)amino]ethylamino]-3-methyl-6-pyridin-4-ylpyrimidin-4-one |
| SMILES | Cn1c(NCCNc2c3c(nc4ccc(F)cc24)CCCC3)nc(-c2ccncc2)cc1=O |
| InChI | InChI=1S/C25H25FN6O/c1-32-23(33)15-22(16-8-10-27-11-9-16)31-25(32)29-13-12-28-24-18-4-2-3-5-20(18)30-21-7-6-17(26)14-19(21)24/h6-11,14-15H,2-5,12-13H2,1H3,(H,28,30)(H,29,31) |
| InChIKey | AJFHRDVVQUBREG-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|