C15H21NO5 — CID 154641411
2-[3,4-bis(2-methoxyethoxy)phenyl]prop-2-enamide (PubChem CID 154641411) has the molecular formula C15H21NO5 and a molecular weight of 295.34 g/mol. Its IUPAC name is 2-[3,4-bis(2-methoxyethoxy)phenyl]prop-2-enamide.
| Compound Name | 2-[3,4-bis(2-methoxyethoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 154641411 |
| Molecular Formula | C15H21NO5 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 2-[3,4-bis(2-methoxyethoxy)phenyl]prop-2-enamide |
| SMILES | C=C(C(N)=O)c1ccc(OCCOC)c(OCCOC)c1 |
| InChI | InChI=1S/C15H21NO5/c1-11(15(16)17)12-4-5-13(20-8-6-18-2)14(10-12)21-9-7-19-3/h4-5,10H,1,6-9H2,2-3H3,(H2,16,17) |
| InChIKey | NKYSSRWZMAXLLC-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|