C6H7F2NO3 — CID 154642714
(2E)-4,4-difluoro-2-(hydroxymethylidene)-3-iminopentanoic acid (PubChem CID 154642714) has the molecular formula C6H7F2NO3 and a molecular weight of 179.12 g/mol. Its IUPAC name is (2E)-4,4-difluoro-2-(hydroxymethylidene)-3-iminopentanoic acid.
| Compound Name | (2E)-4,4-difluoro-2-(hydroxymethylidene)-3-iminopentanoic acid |
|---|---|
| PubChem CID | 154642714 |
| Molecular Formula | C6H7F2NO3 |
| Molecular Weight | 179.12 g/mol |
| Exact Mass | 179.04 |
| IUPAC Name | (2E)-4,4-difluoro-2-(hydroxymethylidene)-3-iminopentanoic acid |
| SMILES | [H]/N=C(C(=C/O)\C(=O)O)/C(C)(F)F |
| InChI | InChI=1S/C6H7F2NO3/c1-6(7,8)4(9)3(2-10)5(11)12/h2,9-10H,1H3,(H,11,12)/b3-2+,9-4+ |
| InChIKey | HLDPWUCTBDJZJQ-DSXPNFDZSA-N |
| XLogP | 1.19 |
| TPSA | 81.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.12 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|