C17H33NO4 — CID 154642812
3-methyl-N-[6-[2-(3-oxobutoxy)ethoxy]hexyl]butanamide (PubChem CID 154642812) has the molecular formula C17H33NO4 and a molecular weight of 315.45 g/mol. Its IUPAC name is 3-methyl-N-[6-[2-(3-oxobutoxy)ethoxy]hexyl]butanamide.
| Compound Name | 3-methyl-N-[6-[2-(3-oxobutoxy)ethoxy]hexyl]butanamide |
|---|---|
| PubChem CID | 154642812 |
| Molecular Formula | C17H33NO4 |
| Molecular Weight | 315.45 g/mol |
| Exact Mass | 315.24 |
| IUPAC Name | 3-methyl-N-[6-[2-(3-oxobutoxy)ethoxy]hexyl]butanamide |
| SMILES | CC(=O)CCOCCOCCCCCCNC(=O)CC(C)C |
| InChI | InChI=1S/C17H33NO4/c1-15(2)14-17(20)18-9-6-4-5-7-10-21-12-13-22-11-8-16(3)19/h15H,4-14H2,1-3H3,(H,18,20) |
| InChIKey | NDQQHXUFBBPNLM-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.45 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|