About N-(5-fluoro-2,4-dimethylphenyl)butan-2-imine;methylcyclopropane
N-(5-fluoro-2,4-dimethylphenyl)butan-2-imine;methylcyclopropane (PubChem CID 154643413) has the molecular formula C16H24FN
and a molecular weight of 249.37 g/mol. Its IUPAC name is N-(5-fluoro-2,4-dimethylphenyl)butan-2-imine;methylcyclopropane.
Molecular Properties
| Compound Name | N-(5-fluoro-2,4-dimethylphenyl)butan-2-imine;methylcyclopropane |
| PubChem CID | 154643413 |
| Molecular Formula | C16H24FN |
| Molecular Weight | 249.37 g/mol |
| Exact Mass | 249.19 |
| IUPAC Name | N-(5-fluoro-2,4-dimethylphenyl)butan-2-imine;methylcyclopropane |
| SMILES | CC/C(C)=N/c1cc(F)c(C)cc1C.CC1CC1 |
| InChI | InChI=1S/C12H16FN.C4H8/c1-5-10(4)14-12-7-11(13)8(2)6-9(12)3;1-4-2-3-4/h6-7H,5H2,1-4H3;4H,2-3H2,1H3/b14-10+; |
| InChIKey | CKKWKRGIJAGYQU-KMZJGFRYSA-N |
| XLogP | 5.36 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 249.37 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(5-fluoro-2,4-dimethylphenyl)butan-2-imine;methylcyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-fluoro-2,4-dimethylphenyl)butan-2-imine;methylcyclopropane?
The IUPAC name of N-(5-fluoro-2,4-dimethylphenyl)butan-2-imine;methylcyclopropane (CID 154643413) is N-(5-fluoro-2,4-dimethylphenyl)butan-2-imine;methylcyclopropane.
What is the SMILES notation for N-(5-fluoro-2,4-dimethylphenyl)butan-2-imine;methylcyclopropane?
The canonical SMILES for N-(5-fluoro-2,4-dimethylphenyl)butan-2-imine;methylcyclopropane is CC/C(C)=N/c1cc(F)c(C)cc1C.CC1CC1.
What is the InChIKey of N-(5-fluoro-2,4-dimethylphenyl)butan-2-imine;methylcyclopropane?
The InChIKey is CKKWKRGIJAGYQU-KMZJGFRYSA-N. The full InChI is InChI=1S/C12H16FN.C4H8/c1-5-10(4)14-12-7-11(13)8(2)6-9(12)3;1-4-2-3-4/h6-7H,5H2,1-4H3;4H,2-3H2,1H3/b14-10+;.
What are the key properties of N-(5-fluoro-2,4-dimethylphenyl)butan-2-imine;methylcyclopropane?
N-(5-fluoro-2,4-dimethylphenyl)butan-2-imine;methylcyclopropane has a molecular weight of 249.37 g/mol, XLogP of 5.36, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-fluoro-2,4-dimethylphenyl)butan-2-imine;methylcyclopropane is sourced from PubChem (CID 154643413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).