C16H24FN — CID 154643413
N-(5-fluoro-2,4-dimethylphenyl)butan-2-imine;methylcyclopropane (PubChem CID 154643413) has the molecular formula C16H24FN and a molecular weight of 249.37 g/mol. Its IUPAC name is N-(5-fluoro-2,4-dimethylphenyl)butan-2-imine;methylcyclopropane.
| Compound Name | N-(5-fluoro-2,4-dimethylphenyl)butan-2-imine;methylcyclopropane |
|---|---|
| PubChem CID | 154643413 |
| Molecular Formula | C16H24FN |
| Molecular Weight | 249.37 g/mol |
| Exact Mass | 249.19 |
| IUPAC Name | N-(5-fluoro-2,4-dimethylphenyl)butan-2-imine;methylcyclopropane |
| SMILES | CC/C(C)=N/c1cc(F)c(C)cc1C.CC1CC1 |
| InChI | InChI=1S/C12H16FN.C4H8/c1-5-10(4)14-12-7-11(13)8(2)6-9(12)3;1-4-2-3-4/h6-7H,5H2,1-4H3;4H,2-3H2,1H3/b14-10+; |
| InChIKey | CKKWKRGIJAGYQU-KMZJGFRYSA-N |
| XLogP | 5.36 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.37 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|