C23H34F2N2 — CID 142397533
(3Z)-2-N-(3,4-difluoro-2-methylphenyl)-3-ethylidene-4-N-methylhexane-2,4-diimine;methylcyclopropane;prop-1-ene (PubChem CID 142397533) has the molecular formula C23H34F2N2 and a molecular weight of 376.54 g/mol. Its IUPAC name is (3Z)-2-N-(3,4-difluoro-2-methylphenyl)-3-ethylidene-4-N-methylhexane-2,4-diimine;methylcyclopropane;prop-1-ene.
| Compound Name | (3Z)-2-N-(3,4-difluoro-2-methylphenyl)-3-ethylidene-4-N-methylhexane-2,4-diimine;methylcyclopropane;prop-1-ene |
|---|---|
| PubChem CID | 142397533 |
| Molecular Formula | C23H34F2N2 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.27 |
| IUPAC Name | (3Z)-2-N-(3,4-difluoro-2-methylphenyl)-3-ethylidene-4-N-methylhexane-2,4-diimine;methylcyclopropane;prop-1-ene |
| SMILES | C/C=C(C(/C)=N/c1ccc(F)c(F)c1C)\C(CC)=N\C.C=CC.CC1CC1 |
| InChI | InChI=1S/C16H20F2N2.C4H8.C3H6/c1-6-12(14(7-2)19-5)11(4)20-15-9-8-13(17)16(18)10(15)3;1-4-2-3-4;1-3-2/h6,8-9H,7H2,1-5H3;4H,2-3H2,1H3;3H,1H2,2H3/b12-6-,19-14+,20-11+;; |
| InChIKey | MXIQLTFPLTZROG-NVVJSIPGSA-N |
| XLogP | 7.40 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|