C12H13F2NO — CID 74931160
N-[1-(3,4-difluorophenyl)-2-methylpent-1-en-3-ylidene]hydroxylamine (PubChem CID 74931160) has the molecular formula C12H13F2NO and a molecular weight of 225.24 g/mol. Its IUPAC name is N-[1-(3,4-difluorophenyl)-2-methylpent-1-en-3-ylidene]hydroxylamine.
| Compound Name | N-[1-(3,4-difluorophenyl)-2-methylpent-1-en-3-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 74931160 |
| Molecular Formula | C12H13F2NO |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | N-[1-(3,4-difluorophenyl)-2-methylpent-1-en-3-ylidene]hydroxylamine |
| SMILES | CCC(=NO)C(C)=Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H13F2NO/c1-3-12(15-16)8(2)6-9-4-5-10(13)11(14)7-9/h4-7,16H,3H2,1-2H3 |
| InChIKey | WRDLKTQRPOZITC-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|