C15H21F2NO — CID 153345686
2-[2,6-difluoro-3-methyl-4-(pentan-2-ylideneamino)phenyl]propan-2-ol (PubChem CID 153345686) has the molecular formula C15H21F2NO and a molecular weight of 269.33 g/mol. Its IUPAC name is 2-[2,6-difluoro-3-methyl-4-(pentan-2-ylideneamino)phenyl]propan-2-ol.
| Compound Name | 2-[2,6-difluoro-3-methyl-4-(pentan-2-ylideneamino)phenyl]propan-2-ol |
|---|---|
| PubChem CID | 153345686 |
| Molecular Formula | C15H21F2NO |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 2-[2,6-difluoro-3-methyl-4-(pentan-2-ylideneamino)phenyl]propan-2-ol |
| SMILES | CCC/C(C)=N/c1cc(F)c(C(C)(C)O)c(F)c1C |
| InChI | InChI=1S/C15H21F2NO/c1-6-7-9(2)18-12-8-11(16)13(15(4,5)19)14(17)10(12)3/h8,19H,6-7H2,1-5H3/b18-9+ |
| InChIKey | PUDHXRJFJHMOIK-GIJQJNRQSA-N |
| XLogP | 4.39 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|