C19H23F3N2OS — CID 146234062
2-[4-methyl-3-(pentan-2-ylideneamino)-5-(1,3-thiazol-2-yl)-2-(trifluoromethyl)phenyl]propan-2-ol (PubChem CID 146234062) has the molecular formula C19H23F3N2OS and a molecular weight of 384.47 g/mol. Its IUPAC name is 2-[4-methyl-3-(pentan-2-ylideneamino)-5-(1,3-thiazol-2-yl)-2-(trifluoromethyl)phenyl]propan-2-ol.
| Compound Name | 2-[4-methyl-3-(pentan-2-ylideneamino)-5-(1,3-thiazol-2-yl)-2-(trifluoromethyl)phenyl]propan-2-ol |
|---|---|
| PubChem CID | 146234062 |
| Molecular Formula | C19H23F3N2OS |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 2-[4-methyl-3-(pentan-2-ylideneamino)-5-(1,3-thiazol-2-yl)-2-(trifluoromethyl)phenyl]propan-2-ol |
| SMILES | CCC/C(C)=N/c1c(C)c(-c2nccs2)cc(C(C)(C)O)c1C(F)(F)F |
| InChI | InChI=1S/C19H23F3N2OS/c1-6-7-11(2)24-16-12(3)13(17-23-8-9-26-17)10-14(18(4,5)25)15(16)19(20,21)22/h8-10,25H,6-7H2,1-5H3/b24-11+ |
| InChIKey | SJSXUXBFVQXIOT-BHGWPJFGSA-N |
| XLogP | 6.26 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|