C12H11F2NOS — CID 151275197
2-[3,5-difluoro-4-(1,3-thiazol-2-yl)phenyl]propan-2-ol (PubChem CID 151275197) has the molecular formula C12H11F2NOS and a molecular weight of 255.29 g/mol. Its IUPAC name is 2-[3,5-difluoro-4-(1,3-thiazol-2-yl)phenyl]propan-2-ol.
| Compound Name | 2-[3,5-difluoro-4-(1,3-thiazol-2-yl)phenyl]propan-2-ol |
|---|---|
| PubChem CID | 151275197 |
| Molecular Formula | C12H11F2NOS |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | 2-[3,5-difluoro-4-(1,3-thiazol-2-yl)phenyl]propan-2-ol |
| SMILES | CC(C)(O)c1cc(F)c(-c2nccs2)c(F)c1 |
| InChI | InChI=1S/C12H11F2NOS/c1-12(2,16)7-5-8(13)10(9(14)6-7)11-15-3-4-17-11/h3-6,16H,1-2H3 |
| InChIKey | NXFAUDJOTDRKPA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |